C9H14N2O3 — CID 170827832
3-amino-1-(6-methoxy-2-pyridinyl)propane-1,2-diol (PubChem CID 170827832) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-amino-1-(6-methoxy-2-pyridinyl)propane-1,2-diol.
| Compound Name | 3-amino-1-(6-methoxy-2-pyridinyl)propane-1,2-diol |
|---|---|
| PubChem CID | 170827832 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3-amino-1-(6-methoxy-2-pyridinyl)propane-1,2-diol |
| SMILES | COc1cccc(C(O)C(O)CN)n1 |
| InChI | InChI=1S/C9H14N2O3/c1-14-8-4-2-3-6(11-8)9(13)7(12)5-10/h2-4,7,9,12-13H,5,10H2,1H3 |
| InChIKey | FDGAWKZUSPLCMN-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |