C10H14N2O3 — CID 124510790
ethyl (2S,3R)-2-amino-3-hydroxy-3-pyridin-2-ylpropanoate (PubChem CID 124510790) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is ethyl (2S,3R)-2-amino-3-hydroxy-3-pyridin-2-ylpropanoate.
| Compound Name | ethyl (2S,3R)-2-amino-3-hydroxy-3-pyridin-2-ylpropanoate |
|---|---|
| PubChem CID | 124510790 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | ethyl (2S,3R)-2-amino-3-hydroxy-3-pyridin-2-ylpropanoate |
| SMILES | CCOC(=O)[C@@H](N)[C@@H](O)c1ccccn1 |
| InChI | InChI=1S/C10H14N2O3/c1-2-15-10(14)8(11)9(13)7-5-3-4-6-12-7/h3-6,8-9,13H,2,11H2,1H3/t8-,9-/m0/s1 |
| InChIKey | OSHMQQLYKVDOGG-IUCAKERBSA-N |
| XLogP | 0.01 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |