C8H11NO2 — CID 28766943
(1S,2S)-1-pyridin-2-ylpropane-1,2-diol (PubChem CID 28766943) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (1S,2S)-1-pyridin-2-ylpropane-1,2-diol.
| Compound Name | (1S,2S)-1-pyridin-2-ylpropane-1,2-diol |
|---|---|
| PubChem CID | 28766943 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (1S,2S)-1-pyridin-2-ylpropane-1,2-diol |
| SMILES | C[C@H](O)[C@@H](O)c1ccccn1 |
| InChI | InChI=1S/C8H11NO2/c1-6(10)8(11)7-4-2-3-5-9-7/h2-6,8,10-11H,1H3/t6-,8+/m0/s1 |
| InChIKey | UPLXVFJRSWFSLM-POYBYMJQSA-N |
| XLogP | 0.50 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |