About ethane;2-methylpropane;2-propan-2-ylpyridine
ethane;2-methylpropane;2-propan-2-ylpyridine (PubChem CID 160963174) has the molecular formula C14H27N
and a molecular weight of 209.38 g/mol. Its IUPAC name is ethane;2-methylpropane;2-propan-2-ylpyridine.
Molecular Properties
| Compound Name | ethane;2-methylpropane;2-propan-2-ylpyridine |
| PubChem CID | 160963174 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | ethane;2-methylpropane;2-propan-2-ylpyridine |
| SMILES | CC.CC(C)C.CC(C)c1ccccn1 |
| InChI | InChI=1S/C8H11N.C4H10.C2H6/c1-7(2)8-5-3-4-6-9-8;1-4(2)3;1-2/h3-7H,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | SXGQACQOVVATGT-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-methylpropane;2-propan-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane;2-propan-2-ylpyridine?
The IUPAC name of ethane;2-methylpropane;2-propan-2-ylpyridine (CID 160963174) is ethane;2-methylpropane;2-propan-2-ylpyridine.
What is the SMILES notation for ethane;2-methylpropane;2-propan-2-ylpyridine?
The canonical SMILES for ethane;2-methylpropane;2-propan-2-ylpyridine is CC.CC(C)C.CC(C)c1ccccn1.
What is the InChIKey of ethane;2-methylpropane;2-propan-2-ylpyridine?
The InChIKey is SXGQACQOVVATGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C4H10.C2H6/c1-7(2)8-5-3-4-6-9-8;1-4(2)3;1-2/h3-7H,1-2H3;4H,1-3H3;1-2H3.
What are the key properties of ethane;2-methylpropane;2-propan-2-ylpyridine?
ethane;2-methylpropane;2-propan-2-ylpyridine has a molecular weight of 209.38 g/mol, XLogP of 4.89, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane;2-propan-2-ylpyridine is sourced from PubChem (CID 160963174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).