About 1-methylpiperidine;2-propan-2-ylpyridine
1-methylpiperidine;2-propan-2-ylpyridine (PubChem CID 156652028) has the molecular formula C14H24N2
and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-methylpiperidine;2-propan-2-ylpyridine.
Molecular Properties
| Compound Name | 1-methylpiperidine;2-propan-2-ylpyridine |
| PubChem CID | 156652028 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 1-methylpiperidine;2-propan-2-ylpyridine |
| SMILES | CC(C)c1ccccn1.CN1CCCCC1 |
| InChI | InChI=1S/C8H11N.C6H13N/c1-7(2)8-5-3-4-6-9-8;1-7-5-3-2-4-6-7/h3-7H,1-2H3;2-6H2,1H3 |
| InChIKey | KDWWRJFKMCNKNF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylpiperidine;2-propan-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidine;2-propan-2-ylpyridine?
The IUPAC name of 1-methylpiperidine;2-propan-2-ylpyridine (CID 156652028) is 1-methylpiperidine;2-propan-2-ylpyridine.
What is the SMILES notation for 1-methylpiperidine;2-propan-2-ylpyridine?
The canonical SMILES for 1-methylpiperidine;2-propan-2-ylpyridine is CC(C)c1ccccn1.CN1CCCCC1.
What is the InChIKey of 1-methylpiperidine;2-propan-2-ylpyridine?
The InChIKey is KDWWRJFKMCNKNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C6H13N/c1-7(2)8-5-3-4-6-9-8;1-7-5-3-2-4-6-7/h3-7H,1-2H3;2-6H2,1H3.
What are the key properties of 1-methylpiperidine;2-propan-2-ylpyridine?
1-methylpiperidine;2-propan-2-ylpyridine has a molecular weight of 220.36 g/mol, XLogP of 3.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidine;2-propan-2-ylpyridine is sourced from PubChem (CID 156652028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).