C12H20ClN3 — CID 86263103
(1-methylpiperidin-4-yl)-pyridin-2-ylmethanamine;hydrochloride (PubChem CID 86263103) has the molecular formula C12H20ClN3 and a molecular weight of 241.77 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl)-pyridin-2-ylmethanamine;hydrochloride.
| Compound Name | (1-methylpiperidin-4-yl)-pyridin-2-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 86263103 |
| Molecular Formula | C12H20ClN3 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (1-methylpiperidin-4-yl)-pyridin-2-ylmethanamine;hydrochloride |
| SMILES | CN1CCC(C(N)c2ccccn2)CC1.Cl |
| InChI | InChI=1S/C12H19N3.ClH/c1-15-8-5-10(6-9-15)12(13)11-4-2-3-7-14-11;/h2-4,7,10,12H,5-6,8-9,13H2,1H3;1H |
| InChIKey | GPLYOTUEWTVZMJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |