About ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine
ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine (PubChem CID 159031608) has the molecular formula C20H34N2
and a molecular weight of 302.51 g/mol. Its IUPAC name is ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine.
Molecular Properties
| Compound Name | ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine |
| PubChem CID | 159031608 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine |
| SMILES | CC.CC.CC(C)c1ccccn1.CC(C)c1ccncc1 |
| InChI | InChI=1S/2C8H11N.2C2H6/c1-7(2)8-3-5-9-6-4-8;1-7(2)8-5-3-4-6-9-8;2*1-2/h2*3-7H,1-2H3;2*1-2H3 |
| InChIKey | JUYOEARXKZHNJO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine?
The IUPAC name of ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine (CID 159031608) is ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine.
What is the SMILES notation for ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine?
The canonical SMILES for ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine is CC.CC.CC(C)c1ccccn1.CC(C)c1ccncc1.
What is the InChIKey of ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine?
The InChIKey is JUYOEARXKZHNJO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H11N.2C2H6/c1-7(2)8-3-5-9-6-4-8;1-7(2)8-5-3-4-6-9-8;2*1-2/h2*3-7H,1-2H3;2*1-2H3.
What are the key properties of ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine?
ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine has a molecular weight of 302.51 g/mol, XLogP of 6.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-propan-2-ylpyridine;4-propan-2-ylpyridine is sourced from PubChem (CID 159031608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).