About 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene
2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene (PubChem CID 162046659) has the molecular formula C18H22F3N
and a molecular weight of 309.38 g/mol. Its IUPAC name is 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene |
| PubChem CID | 162046659 |
| Molecular Formula | C18H22F3N |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene |
| SMILES | CC(C)c1ccc(C(F)(F)F)cc1.CC(C)c1ccccn1 |
| InChI | InChI=1S/C10H11F3.C8H11N/c1-7(2)8-3-5-9(6-4-8)10(11,12)13;1-7(2)8-5-3-4-6-9-8/h3-7H,1-2H3;3-7H,1-2H3 |
| InChIKey | YXYZYQGOMJAJMT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene?
The IUPAC name of 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene (CID 162046659) is 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene.
What is the SMILES notation for 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene?
The canonical SMILES for 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene is CC(C)c1ccc(C(F)(F)F)cc1.CC(C)c1ccccn1.
What is the InChIKey of 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene?
The InChIKey is YXYZYQGOMJAJMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F3.C8H11N/c1-7(2)8-3-5-9(6-4-8)10(11,12)13;1-7(2)8-5-3-4-6-9-8/h3-7H,1-2H3;3-7H,1-2H3.
What are the key properties of 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene?
2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene has a molecular weight of 309.38 g/mol, XLogP of 6.03, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-ylpyridine;1-propan-2-yl-4-(trifluoromethyl)benzene is sourced from PubChem (CID 162046659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).