About cumene;methane;1-methylpiperidine
cumene;methane;1-methylpiperidine (PubChem CID 177007302) has the molecular formula C16H29N
and a molecular weight of 235.42 g/mol. Its IUPAC name is cumene;methane;1-methylpiperidine.
Molecular Properties
| Compound Name | cumene;methane;1-methylpiperidine |
| PubChem CID | 177007302 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.42 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | cumene;methane;1-methylpiperidine |
| SMILES | C.CC(C)c1ccccc1.CN1CCCCC1 |
| InChI | InChI=1S/C9H12.C6H13N.CH4/c1-8(2)9-6-4-3-5-7-9;1-7-5-3-2-4-6-7;/h3-8H,1-2H3;2-6H2,1H3;1H4 |
| InChIKey | RXBISVZXMSEAMS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cumene;methane;1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;methane;1-methylpiperidine?
The IUPAC name of cumene;methane;1-methylpiperidine (CID 177007302) is cumene;methane;1-methylpiperidine.
What is the SMILES notation for cumene;methane;1-methylpiperidine?
The canonical SMILES for cumene;methane;1-methylpiperidine is C.CC(C)c1ccccc1.CN1CCCCC1.
What is the InChIKey of cumene;methane;1-methylpiperidine?
The InChIKey is RXBISVZXMSEAMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C6H13N.CH4/c1-8(2)9-6-4-3-5-7-9;1-7-5-3-2-4-6-7;/h3-8H,1-2H3;2-6H2,1H3;1H4.
What are the key properties of cumene;methane;1-methylpiperidine?
cumene;methane;1-methylpiperidine has a molecular weight of 235.42 g/mol, XLogP of 4.55, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;methane;1-methylpiperidine is sourced from PubChem (CID 177007302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).