About cumene;methane;molecular iodine
cumene;methane;molecular iodine (PubChem CID 161218326) has the molecular formula C12H24I2
and a molecular weight of 422.13 g/mol. Its IUPAC name is cumene;methane;molecular iodine.
Molecular Properties
| Compound Name | cumene;methane;molecular iodine |
| PubChem CID | 161218326 |
| Molecular Formula | C12H24I2 |
| Molecular Weight | 422.13 g/mol |
| Exact Mass | 422.00 |
| IUPAC Name | cumene;methane;molecular iodine |
| SMILES | C.C.C.CC(C)c1ccccc1.II |
| InChI | InChI=1S/C9H12.3CH4.I2/c1-8(2)9-6-4-3-5-7-9;;;;1-2/h3-8H,1-2H3;3*1H4; |
| InChIKey | UXEBBSGVCFTFDK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.13 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze cumene;methane;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;methane;molecular iodine?
The IUPAC name of cumene;methane;molecular iodine (CID 161218326) is cumene;methane;molecular iodine.
What is the SMILES notation for cumene;methane;molecular iodine?
The canonical SMILES for cumene;methane;molecular iodine is C.C.C.CC(C)c1ccccc1.II.
What is the InChIKey of cumene;methane;molecular iodine?
The InChIKey is UXEBBSGVCFTFDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.3CH4.I2/c1-8(2)9-6-4-3-5-7-9;;;;1-2/h3-8H,1-2H3;3*1H4;.
What are the key properties of cumene;methane;molecular iodine?
cumene;methane;molecular iodine has a molecular weight of 422.13 g/mol, XLogP of 6.49, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;methane;molecular iodine is sourced from PubChem (CID 161218326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).