C10H13NO2 — CID 130697576
(3S,4R)-4-hydroxy-3-methyl-4-pyridin-2-ylbutan-2-one (PubChem CID 130697576) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (3S,4R)-4-hydroxy-3-methyl-4-pyridin-2-ylbutan-2-one.
| Compound Name | (3S,4R)-4-hydroxy-3-methyl-4-pyridin-2-ylbutan-2-one |
|---|---|
| PubChem CID | 130697576 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (3S,4R)-4-hydroxy-3-methyl-4-pyridin-2-ylbutan-2-one |
| SMILES | CC(=O)[C@@H](C)[C@@H](O)c1ccccn1 |
| InChI | InChI=1S/C10H13NO2/c1-7(8(2)12)10(13)9-5-3-4-6-11-9/h3-7,10,13H,1-2H3/t7-,10-/m1/s1 |
| InChIKey | DYDAFRUUJLDDRN-GMSGAONNSA-N |
| XLogP | 1.34 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |