About 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol
2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol (PubChem CID 161183941) has the molecular formula C14H17FN2O
and a molecular weight of 248.30 g/mol. Its IUPAC name is 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol.
Molecular Properties
| Compound Name | 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol |
| PubChem CID | 161183941 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol |
| SMILES | CC(F)c1ccccn1.CC(O)c1ccccn1 |
| InChI | InChI=1S/C7H8FN.C7H9NO/c1-6(8)7-4-2-3-5-9-7;1-6(9)7-4-2-3-5-8-7/h2-6H,1H3;2-6,9H,1H3 |
| InChIKey | USVMFADDTZYMAS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol?
The IUPAC name of 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol (CID 161183941) is 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol.
What is the SMILES notation for 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol?
The canonical SMILES for 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol is CC(F)c1ccccn1.CC(O)c1ccccn1.
What is the InChIKey of 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol?
The InChIKey is USVMFADDTZYMAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN.C7H9NO/c1-6(8)7-4-2-3-5-9-7;1-6(9)7-4-2-3-5-8-7/h2-6H,1H3;2-6,9H,1H3.
What are the key properties of 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol?
2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol has a molecular weight of 248.30 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-fluoroethyl)pyridine;1-pyridin-2-ylethanol is sourced from PubChem (CID 161183941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).