About dipyridin-2-ylmethanol;palladium(2+);dichloride
dipyridin-2-ylmethanol;palladium(2+);dichloride (PubChem CID 173385206) has the molecular formula C11H10Cl2N2OPd
and a molecular weight of 363.54 g/mol. Its IUPAC name is dipyridin-2-ylmethanol;palladium(2+);dichloride.
Molecular Properties
| Compound Name | dipyridin-2-ylmethanol;palladium(2+);dichloride |
| PubChem CID | 173385206 |
| Molecular Formula | C11H10Cl2N2OPd |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 361.92 |
| IUPAC Name | dipyridin-2-ylmethanol;palladium(2+);dichloride |
| SMILES | OC(c1ccccn1)c1ccccn1.[Cl-].[Cl-].[Pd+2] |
| InChI | InChI=1S/C11H10N2O.2ClH.Pd/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10;;;/h1-8,11,14H;2*1H;/q;;;+2/p-2 |
| InChIKey | CMGANEPJCVXDJX-UHFFFAOYSA-L |
| XLogP | -4.44 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dipyridin-2-ylmethanol;palladium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipyridin-2-ylmethanol;palladium(2+);dichloride?
The IUPAC name of dipyridin-2-ylmethanol;palladium(2+);dichloride (CID 173385206) is dipyridin-2-ylmethanol;palladium(2+);dichloride.
What is the SMILES notation for dipyridin-2-ylmethanol;palladium(2+);dichloride?
The canonical SMILES for dipyridin-2-ylmethanol;palladium(2+);dichloride is OC(c1ccccn1)c1ccccn1.[Cl-].[Cl-].[Pd+2].
What is the InChIKey of dipyridin-2-ylmethanol;palladium(2+);dichloride?
The InChIKey is CMGANEPJCVXDJX-UHFFFAOYSA-L. The full InChI is InChI=1S/C11H10N2O.2ClH.Pd/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10;;;/h1-8,11,14H;2*1H;/q;;;+2/p-2.
What are the key properties of dipyridin-2-ylmethanol;palladium(2+);dichloride?
dipyridin-2-ylmethanol;palladium(2+);dichloride has a molecular weight of 363.54 g/mol, XLogP of -4.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dipyridin-2-ylmethanol;palladium(2+);dichloride is sourced from PubChem (CID 173385206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).