C15H17NO — CID 154106044
pyridin-2-yl-(2,4,6-trimethylphenyl)methanol (PubChem CID 154106044) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is pyridin-2-yl-(2,4,6-trimethylphenyl)methanol.
| Compound Name | pyridin-2-yl-(2,4,6-trimethylphenyl)methanol |
|---|---|
| PubChem CID | 154106044 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | pyridin-2-yl-(2,4,6-trimethylphenyl)methanol |
| SMILES | Cc1cc(C)c(C(O)c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C15H17NO/c1-10-8-11(2)14(12(3)9-10)15(17)13-6-4-5-7-16-13/h4-9,15,17H,1-3H3 |
| InChIKey | NNMDNGYGADNPEI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |