C12H14ClN3O3 — CID 171259188
3-[(1R)-1-amino-3-methylbut-3-enyl]-4-hydroxy-5-nitrobenzonitrile;hydrochloride (PubChem CID 171259188) has the molecular formula C12H14ClN3O3 and a molecular weight of 283.72 g/mol. Its IUPAC name is 3-[(1R)-1-amino-3-methylbut-3-enyl]-4-hydroxy-5-nitrobenzonitrile;hydrochloride.
| Compound Name | 3-[(1R)-1-amino-3-methylbut-3-enyl]-4-hydroxy-5-nitrobenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171259188 |
| Molecular Formula | C12H14ClN3O3 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 3-[(1R)-1-amino-3-methylbut-3-enyl]-4-hydroxy-5-nitrobenzonitrile;hydrochloride |
| SMILES | C=C(C)C[C@@H](N)c1cc(C#N)cc([N+](=O)[O-])c1O.Cl |
| InChI | InChI=1S/C12H13N3O3.ClH/c1-7(2)3-10(14)9-4-8(6-13)5-11(12(9)16)15(17)18;/h4-5,10,16H,1,3,14H2,2H3;1H/t10-;/m1./s1 |
| InChIKey | DTEJCLWJIXVAQQ-HNCPQSOCSA-N |
| XLogP | 2.56 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|