C20H20N4O4 — CID 161010147
3-amino-4-hydroxy-5-propan-2-ylbenzonitrile;4-hydroxy-3-nitro-5-prop-1-en-2-ylbenzonitrile (PubChem CID 161010147) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 3-amino-4-hydroxy-5-propan-2-ylbenzonitrile;4-hydroxy-3-nitro-5-prop-1-en-2-ylbenzonitrile.
| Compound Name | 3-amino-4-hydroxy-5-propan-2-ylbenzonitrile;4-hydroxy-3-nitro-5-prop-1-en-2-ylbenzonitrile |
|---|---|
| PubChem CID | 161010147 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-amino-4-hydroxy-5-propan-2-ylbenzonitrile;4-hydroxy-3-nitro-5-prop-1-en-2-ylbenzonitrile |
| SMILES | C=C(C)c1cc(C#N)cc([N+](=O)[O-])c1O.CC(C)c1cc(C#N)cc(N)c1O |
| InChI | InChI=1S/C10H8N2O3.C10H12N2O/c1-6(2)8-3-7(5-11)4-9(10(8)13)12(14)15;1-6(2)8-3-7(5-11)4-9(12)10(8)13/h3-4,13H,1H2,2H3;3-4,6,13H,12H2,1-2H3 |
| InChIKey | TXAJJAHERNBNLA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|