C10H12ClN3O3 — CID 171259133
3-[(1R)-1-aminopropyl]-4-hydroxy-5-nitrobenzonitrile;hydrochloride (PubChem CID 171259133) has the molecular formula C10H12ClN3O3 and a molecular weight of 257.68 g/mol. Its IUPAC name is 3-[(1R)-1-aminopropyl]-4-hydroxy-5-nitrobenzonitrile;hydrochloride.
| Compound Name | 3-[(1R)-1-aminopropyl]-4-hydroxy-5-nitrobenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 171259133 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 3-[(1R)-1-aminopropyl]-4-hydroxy-5-nitrobenzonitrile;hydrochloride |
| SMILES | CC[C@@H](N)c1cc(C#N)cc([N+](=O)[O-])c1O.Cl |
| InChI | InChI=1S/C10H11N3O3.ClH/c1-2-8(12)7-3-6(5-11)4-9(10(7)14)13(15)16;/h3-4,8,14H,2,12H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | BSZIIEILBPITFW-DDWIOCJRSA-N |
| XLogP | 2.00 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|