C26H27N3O7 — CID 171887536
9H-fluoren-9-ylmethyl N-[4-(2-amino-5-methoxy-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171887536) has the molecular formula C26H27N3O7 and a molecular weight of 493.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(2-amino-5-methoxy-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(2-amino-5-methoxy-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887536 |
| Molecular Formula | C26H27N3O7 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(2-amino-5-methoxy-3-nitrophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | COc1cc(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)c(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H27N3O7/c1-35-15-12-20(24(27)22(13-15)29(33)34)25(31)23(30)10-11-28-26(32)36-14-21-18-8-4-2-6-16(18)17-7-3-5-9-19(17)21/h2-9,12-13,21,23,25,30-31H,10-11,14,27H2,1H3,(H,28,32) |
| InChIKey | XYKBWJVTQVZYFF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|