C24H23ClN4O6 — CID 171887354
9H-fluoren-9-ylmethyl N-[4-(6-amino-2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171887354) has the molecular formula C24H23ClN4O6 and a molecular weight of 498.92 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(6-amino-2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(6-amino-2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887354 |
| Molecular Formula | C24H23ClN4O6 |
| Molecular Weight | 498.92 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(6-amino-2-chloro-5-nitro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | Nc1nc(Cl)c(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H23ClN4O6/c25-22-17(11-19(29(33)34)23(26)28-22)21(31)20(30)9-10-27-24(32)35-12-18-15-7-3-1-5-13(15)14-6-2-4-8-16(14)18/h1-8,11,18,20-21,30-31H,9-10,12H2,(H2,26,28)(H,27,32) |
| InChIKey | WHTNFCYOEPYFAK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 160.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.92 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|