C25H22N4O6 — CID 171887356
9H-fluoren-9-ylmethyl N-[4-(6-cyano-5-nitro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171887356) has the molecular formula C25H22N4O6 and a molecular weight of 474.47 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(6-cyano-5-nitro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(6-cyano-5-nitro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171887356 |
| Molecular Formula | C25H22N4O6 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(6-cyano-5-nitro-3-pyridinyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | N#Cc1ncc(C(O)C(O)CCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H22N4O6/c26-12-21-22(29(33)34)11-15(13-28-21)24(31)23(30)9-10-27-25(32)35-14-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-8,11,13,20,23-24,30-31H,9-10,14H2,(H,27,32) |
| InChIKey | IINJGDAVKVITHG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 158.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|