C26H23F3N2O6 — CID 171887598
9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[3-nitro-5-(trifluoromethyl)phenyl]butyl]carbamate (PubChem CID 171887598) has the molecular formula C26H23F3N2O6 and a molecular weight of 516.47 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[3-nitro-5-(trifluoromethyl)phenyl]butyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[3-nitro-5-(trifluoromethyl)phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 171887598 |
| Molecular Formula | C26H23F3N2O6 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[3-nitro-5-(trifluoromethyl)phenyl]butyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1cc([N+](=O)[O-])cc(C(F)(F)F)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H23F3N2O6/c27-26(28,29)16-11-15(12-17(13-16)31(35)36)24(33)23(32)9-10-30-25(34)37-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-8,11-13,22-24,32-33H,9-10,14H2,(H,30,34) |
| InChIKey | GHWGMXNHOGTYOI-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|