C26H22F3NO5 — CID 170835049
9H-fluoren-9-ylmethyl N-[3-[3-formyl-5-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl]carbamate (PubChem CID 170835049) has the molecular formula C26H22F3NO5 and a molecular weight of 485.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[3-formyl-5-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[3-formyl-5-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170835049 |
| Molecular Formula | C26H22F3NO5 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[3-formyl-5-(trifluoromethyl)phenyl]-2,3-dihydroxypropyl]carbamate |
| SMILES | O=Cc1cc(C(O)C(O)CNC(=O)OCC2c3ccccc3-c3ccccc32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H22F3NO5/c27-26(28,29)17-10-15(13-31)9-16(11-17)24(33)23(32)12-30-25(34)35-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-11,13,22-24,32-33H,12,14H2,(H,30,34) |
| InChIKey | BDZIRCXPVVWELP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|