C26H23F4NO5 — CID 170835123
9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]carbamate (PubChem CID 170835123) has the molecular formula C26H23F4NO5 and a molecular weight of 505.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 170835123 |
| Molecular Formula | C26H23F4NO5 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]propyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1cccc(OC(F)(F)C(F)F)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H23F4NO5/c27-24(28)26(29,30)36-16-7-5-6-15(12-16)23(33)22(32)13-31-25(34)35-14-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-12,21-24,32-33H,13-14H2,(H,31,34) |
| InChIKey | JXAWORXOFUJTEX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|