C27H25F4NO5 — CID 171887583
9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]carbamate (PubChem CID 171887583) has the molecular formula C27H25F4NO5 and a molecular weight of 519.49 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]carbamate |
|---|---|
| PubChem CID | 171887583 |
| Molecular Formula | C27H25F4NO5 |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.17 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3,4-dihydroxy-4-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]butyl]carbamate |
| SMILES | O=C(NCCC(O)C(O)c1cccc(OC(F)(F)C(F)F)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H25F4NO5/c28-25(29)27(30,31)37-17-7-5-6-16(14-17)24(34)23(33)12-13-32-26(35)36-15-22-20-10-3-1-8-18(20)19-9-2-4-11-21(19)22/h1-11,14,22-25,33-34H,12-13,15H2,(H,32,35) |
| InChIKey | YBNLRBRNBOEVGK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|