C25H22N2O4S — CID 170834186
9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(3-isothiocyanatophenyl)propyl]carbamate (PubChem CID 170834186) has the molecular formula C25H22N2O4S and a molecular weight of 446.53 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(3-isothiocyanatophenyl)propyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(3-isothiocyanatophenyl)propyl]carbamate |
|---|---|
| PubChem CID | 170834186 |
| Molecular Formula | C25H22N2O4S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[2,3-dihydroxy-3-(3-isothiocyanatophenyl)propyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1cccc(N=C=S)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H22N2O4S/c28-23(24(29)16-6-5-7-17(12-16)27-15-32)13-26-25(30)31-14-22-20-10-3-1-8-18(20)19-9-2-4-11-21(19)22/h1-12,22-24,28-29H,13-14H2,(H,26,30) |
| InChIKey | CTDKGOXOAJUJHA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|