C25H21ClN2O4S — CID 170834592
9H-fluoren-9-ylmethyl N-[3-(3-chloro-4-isothiocyanatophenyl)-2,3-dihydroxypropyl]carbamate (PubChem CID 170834592) has the molecular formula C25H21ClN2O4S and a molecular weight of 480.97 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-(3-chloro-4-isothiocyanatophenyl)-2,3-dihydroxypropyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-(3-chloro-4-isothiocyanatophenyl)-2,3-dihydroxypropyl]carbamate |
|---|---|
| PubChem CID | 170834592 |
| Molecular Formula | C25H21ClN2O4S |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-(3-chloro-4-isothiocyanatophenyl)-2,3-dihydroxypropyl]carbamate |
| SMILES | O=C(NCC(O)C(O)c1ccc(N=C=S)c(Cl)c1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H21ClN2O4S/c26-21-11-15(9-10-22(21)28-14-33)24(30)23(29)12-27-25(31)32-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-11,20,23-24,29-30H,12-13H2,(H,27,31) |
| InChIKey | CCESYGHCAIJKBY-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|