C20H20F3NO5 — CID 171889301
benzyl N-[4-[3-formyl-5-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]carbamate (PubChem CID 171889301) has the molecular formula C20H20F3NO5 and a molecular weight of 411.38 g/mol. Its IUPAC name is benzyl N-[4-[3-formyl-5-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-[3-formyl-5-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171889301 |
| Molecular Formula | C20H20F3NO5 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | benzyl N-[4-[3-formyl-5-(trifluoromethyl)phenyl]-3,4-dihydroxybutyl]carbamate |
| SMILES | O=Cc1cc(C(O)C(O)CCNC(=O)OCc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F3NO5/c21-20(22,23)16-9-14(11-25)8-15(10-16)18(27)17(26)6-7-24-19(28)29-12-13-4-2-1-3-5-13/h1-5,8-11,17-18,26-27H,6-7,12H2,(H,24,28) |
| InChIKey | LSVAVAAWBOJWNL-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|