C11H15N3O4 — CID 171879327
4-azido-1-(2-hydroxy-5-methoxyphenyl)butane-1,2-diol (PubChem CID 171879327) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 4-azido-1-(2-hydroxy-5-methoxyphenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(2-hydroxy-5-methoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879327 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 4-azido-1-(2-hydroxy-5-methoxyphenyl)butane-1,2-diol |
| SMILES | COc1ccc(O)c(C(O)C(O)CCN=[N+]=[N-])c1 |
| InChI | InChI=1S/C11H15N3O4/c1-18-7-2-3-9(15)8(6-7)11(17)10(16)4-5-13-14-12/h2-3,6,10-11,15-17H,4-5H2,1H3 |
| InChIKey | TXWGNOVFORFNOI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|