C10H12ClN3O3 — CID 171879057
4-azido-1-(2-chloro-5-hydroxyphenyl)butane-1,2-diol (PubChem CID 171879057) has the molecular formula C10H12ClN3O3 and a molecular weight of 257.68 g/mol. Its IUPAC name is 4-azido-1-(2-chloro-5-hydroxyphenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(2-chloro-5-hydroxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879057 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 4-azido-1-(2-chloro-5-hydroxyphenyl)butane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C10H12ClN3O3/c11-8-2-1-6(15)5-7(8)10(17)9(16)3-4-13-14-12/h1-2,5,9-10,15-17H,3-4H2 |
| InChIKey | QRMJZKUKUACVGT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|