C12H16N4O4 — CID 171880139
2-amino-3-(4-azido-1,2-dihydroxybutyl)-5-methylbenzoic acid (PubChem CID 171880139) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-amino-3-(4-azido-1,2-dihydroxybutyl)-5-methylbenzoic acid.
| Compound Name | 2-amino-3-(4-azido-1,2-dihydroxybutyl)-5-methylbenzoic acid |
|---|---|
| PubChem CID | 171880139 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-amino-3-(4-azido-1,2-dihydroxybutyl)-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)c(N)c(C(O)C(O)CCN=[N+]=[N-])c1 |
| InChI | InChI=1S/C12H16N4O4/c1-6-4-7(10(13)8(5-6)12(19)20)11(18)9(17)2-3-15-16-14/h4-5,9,11,17-18H,2-3,13H2,1H3,(H,19,20) |
| InChIKey | MJLMMFCDGUVQTI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 152.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|