C10H13N5O4 — CID 171879842
6-amino-5-(4-azido-1,2-dihydroxybutyl)pyridine-3-carboxylic acid (PubChem CID 171879842) has the molecular formula C10H13N5O4 and a molecular weight of 267.25 g/mol. Its IUPAC name is 6-amino-5-(4-azido-1,2-dihydroxybutyl)pyridine-3-carboxylic acid.
| Compound Name | 6-amino-5-(4-azido-1,2-dihydroxybutyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 171879842 |
| Molecular Formula | C10H13N5O4 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-amino-5-(4-azido-1,2-dihydroxybutyl)pyridine-3-carboxylic acid |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1cc(C(=O)O)cnc1N |
| InChI | InChI=1S/C10H13N5O4/c11-9-6(3-5(4-13-9)10(18)19)8(17)7(16)1-2-14-15-12/h3-4,7-8,16-17H,1-2H2,(H2,11,13)(H,18,19) |
| InChIKey | BHOCMHBPRQWQSK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 165.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|