C10H15N5O2 — CID 171879144
1-(6-amino-4-methyl-3-pyridinyl)-4-azidobutane-1,2-diol (PubChem CID 171879144) has the molecular formula C10H15N5O2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-(6-amino-4-methyl-3-pyridinyl)-4-azidobutane-1,2-diol.
| Compound Name | 1-(6-amino-4-methyl-3-pyridinyl)-4-azidobutane-1,2-diol |
|---|---|
| PubChem CID | 171879144 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(6-amino-4-methyl-3-pyridinyl)-4-azidobutane-1,2-diol |
| SMILES | Cc1cc(N)ncc1C(O)C(O)CCN=[N+]=[N-] |
| InChI | InChI=1S/C10H15N5O2/c1-6-4-9(11)13-5-7(6)10(17)8(16)2-3-14-15-12/h4-5,8,10,16-17H,2-3H2,1H3,(H2,11,13) |
| InChIKey | FOCSLSYZHZNYLT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|