C10H13FN4O2 — CID 171880561
4-azido-1-(2-fluoro-3-methyl-4-pyridinyl)butane-1,2-diol (PubChem CID 171880561) has the molecular formula C10H13FN4O2 and a molecular weight of 240.24 g/mol. Its IUPAC name is 4-azido-1-(2-fluoro-3-methyl-4-pyridinyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(2-fluoro-3-methyl-4-pyridinyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171880561 |
| Molecular Formula | C10H13FN4O2 |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-azido-1-(2-fluoro-3-methyl-4-pyridinyl)butane-1,2-diol |
| SMILES | Cc1c(C(O)C(O)CCN=[N+]=[N-])ccnc1F |
| InChI | InChI=1S/C10H13FN4O2/c1-6-7(2-4-13-10(6)11)9(17)8(16)3-5-14-15-12/h2,4,8-9,16-17H,3,5H2,1H3 |
| InChIKey | ANSHMGYEMDDFBH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 102.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|