C12H14N4O3 — CID 171879956
4-(4-azido-1,2-dihydroxybutyl)-2-methoxybenzonitrile (PubChem CID 171879956) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 4-(4-azido-1,2-dihydroxybutyl)-2-methoxybenzonitrile.
| Compound Name | 4-(4-azido-1,2-dihydroxybutyl)-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 171879956 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 4-(4-azido-1,2-dihydroxybutyl)-2-methoxybenzonitrile |
| SMILES | COc1cc(C(O)C(O)CCN=[N+]=[N-])ccc1C#N |
| InChI | InChI=1S/C12H14N4O3/c1-19-11-6-8(2-3-9(11)7-13)12(18)10(17)4-5-15-16-14/h2-3,6,10,12,17-18H,4-5H2,1H3 |
| InChIKey | KKMWAYGJAKNLSK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|