C13H16N2O4 — CID 170830549
N-[3-(4-cyano-3-methoxyphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830549) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is N-[3-(4-cyano-3-methoxyphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(4-cyano-3-methoxyphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830549 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N-[3-(4-cyano-3-methoxyphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | COc1cc(C(O)C(O)CNC(C)=O)ccc1C#N |
| InChI | InChI=1S/C13H16N2O4/c1-8(16)15-7-11(17)13(18)9-3-4-10(6-14)12(5-9)19-2/h3-5,11,13,17-18H,7H2,1-2H3,(H,15,16) |
| InChIKey | FPWYZGFMWCNZGE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |