C12H14N2O4 — CID 170830168
N-[3-(3-cyano-4-hydroxyphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830168) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is N-[3-(3-cyano-4-hydroxyphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(3-cyano-4-hydroxyphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830168 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | N-[3-(3-cyano-4-hydroxyphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1ccc(O)c(C#N)c1 |
| InChI | InChI=1S/C12H14N2O4/c1-7(15)14-6-11(17)12(18)8-2-3-10(16)9(4-8)5-13/h2-4,11-12,16-18H,6H2,1H3,(H,14,15) |
| InChIKey | RCFVIIHBTSZIBD-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |