C13H15NO5 — CID 171897492
ethyl 4-(3-cyano-4-hydroxyphenyl)-3,4-dihydroxybutanoate (PubChem CID 171897492) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is ethyl 4-(3-cyano-4-hydroxyphenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(3-cyano-4-hydroxyphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897492 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | ethyl 4-(3-cyano-4-hydroxyphenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(O)c(C#N)c1 |
| InChI | InChI=1S/C13H15NO5/c1-2-19-12(17)6-11(16)13(18)8-3-4-10(15)9(5-8)7-14/h3-5,11,13,15-16,18H,2,6H2,1H3 |
| InChIKey | MWEIOQAWWFYFIE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |