C13H15NO4 — CID 171895641
methyl 4-(4-cyano-3-methylphenyl)-3,4-dihydroxybutanoate (PubChem CID 171895641) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl 4-(4-cyano-3-methylphenyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(4-cyano-3-methylphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171895641 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl 4-(4-cyano-3-methylphenyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc(C#N)c(C)c1 |
| InChI | InChI=1S/C13H15NO4/c1-8-5-9(3-4-10(8)7-14)13(17)11(15)6-12(16)18-2/h3-5,11,13,15,17H,6H2,1-2H3 |
| InChIKey | LNOIMPQSURIZFN-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |