C12H14N2O4 — CID 171895559
methyl 4-(4-amino-3-cyanophenyl)-3,4-dihydroxybutanoate (PubChem CID 171895559) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is methyl 4-(4-amino-3-cyanophenyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(4-amino-3-cyanophenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171895559 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | methyl 4-(4-amino-3-cyanophenyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc(N)c(C#N)c1 |
| InChI | InChI=1S/C12H14N2O4/c1-18-11(16)5-10(15)12(17)7-2-3-9(14)8(4-7)6-13/h2-4,10,12,15,17H,5,14H2,1H3 |
| InChIKey | WVGVAYDJYRSYOF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|