C11H12ClNO6 — CID 171896037
methyl 4-(4-chloro-3-nitrophenyl)-3,4-dihydroxybutanoate (PubChem CID 171896037) has the molecular formula C11H12ClNO6 and a molecular weight of 289.67 g/mol. Its IUPAC name is methyl 4-(4-chloro-3-nitrophenyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(4-chloro-3-nitrophenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171896037 |
| Molecular Formula | C11H12ClNO6 |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | methyl 4-(4-chloro-3-nitrophenyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12ClNO6/c1-19-10(15)5-9(14)11(16)6-2-3-7(12)8(4-6)13(17)18/h2-4,9,11,14,16H,5H2,1H3 |
| InChIKey | RHQOCFJRYOGHIO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|