C10H13ClN2O3 — CID 171268516
(1S,2R)-1-amino-1-(4-chloro-3-nitrophenyl)butan-2-ol (PubChem CID 171268516) has the molecular formula C10H13ClN2O3 and a molecular weight of 244.68 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(4-chloro-3-nitrophenyl)butan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(4-chloro-3-nitrophenyl)butan-2-ol |
|---|---|
| PubChem CID | 171268516 |
| Molecular Formula | C10H13ClN2O3 |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | (1S,2R)-1-amino-1-(4-chloro-3-nitrophenyl)butan-2-ol |
| SMILES | CC[C@@H](O)[C@@H](N)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H13ClN2O3/c1-2-9(14)10(12)6-3-4-7(11)8(5-6)13(15)16/h3-5,9-10,14H,2,12H2,1H3/t9-,10+/m1/s1 |
| InChIKey | ZSOFRFOJLZQUNR-ZJUUUORDSA-N |
| XLogP | 2.02 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|