C8H5ClF3NO3 — CID 124549223
(1S)-1-(4-chloro-3-nitrophenyl)-2,2,2-trifluoroethanol (PubChem CID 124549223) has the molecular formula C8H5ClF3NO3 and a molecular weight of 255.58 g/mol. Its IUPAC name is (1S)-1-(4-chloro-3-nitrophenyl)-2,2,2-trifluoroethanol.
| Compound Name | (1S)-1-(4-chloro-3-nitrophenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 124549223 |
| Molecular Formula | C8H5ClF3NO3 |
| Molecular Weight | 255.58 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | (1S)-1-(4-chloro-3-nitrophenyl)-2,2,2-trifluoroethanol |
| SMILES | O=[N+]([O-])c1cc([C@H](O)C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C8H5ClF3NO3/c9-5-2-1-4(3-6(5)13(15)16)7(14)8(10,11)12/h1-3,7,14H/t7-/m0/s1 |
| InChIKey | YBDSSQNQHMOOKM-ZETCQYMHSA-N |
| XLogP | 2.84 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|