C9H9ClF2N2O2 — CID 171313698
(1R)-1-(4-chloro-3-nitrophenyl)-3,3-difluoropropan-1-amine (PubChem CID 171313698) has the molecular formula C9H9ClF2N2O2 and a molecular weight of 250.63 g/mol. Its IUPAC name is (1R)-1-(4-chloro-3-nitrophenyl)-3,3-difluoropropan-1-amine.
| Compound Name | (1R)-1-(4-chloro-3-nitrophenyl)-3,3-difluoropropan-1-amine |
|---|---|
| PubChem CID | 171313698 |
| Molecular Formula | C9H9ClF2N2O2 |
| Molecular Weight | 250.63 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | (1R)-1-(4-chloro-3-nitrophenyl)-3,3-difluoropropan-1-amine |
| SMILES | N[C@H](CC(F)F)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9ClF2N2O2/c10-6-2-1-5(3-8(6)14(15)16)7(13)4-9(11)12/h1-3,7,9H,4,13H2/t7-/m1/s1 |
| InChIKey | OSYOSPYXNXKBPM-SSDOTTSWSA-N |
| XLogP | 2.90 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.63 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|