C11H14Cl2N2O2 — CID 171206339
(1R)-1-(4-chloro-3-nitrophenyl)-2-cyclopropylethanamine;hydrochloride (PubChem CID 171206339) has the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.15 g/mol. Its IUPAC name is (1R)-1-(4-chloro-3-nitrophenyl)-2-cyclopropylethanamine;hydrochloride.
| Compound Name | (1R)-1-(4-chloro-3-nitrophenyl)-2-cyclopropylethanamine;hydrochloride |
|---|---|
| PubChem CID | 171206339 |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | (1R)-1-(4-chloro-3-nitrophenyl)-2-cyclopropylethanamine;hydrochloride |
| SMILES | Cl.N[C@H](CC1CC1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13ClN2O2.ClH/c12-9-4-3-8(6-11(9)14(15)16)10(13)5-7-1-2-7;/h3-4,6-7,10H,1-2,5,13H2;1H/t10-;/m1./s1 |
| InChIKey | YGLNHCZADCCTGC-HNCPQSOCSA-N |
| XLogP | 3.47 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|