C13H14ClNO4 — CID 171897418
ethyl 4-(4-chloro-2-cyanophenyl)-3,4-dihydroxybutanoate (PubChem CID 171897418) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is ethyl 4-(4-chloro-2-cyanophenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(4-chloro-2-cyanophenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897418 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | ethyl 4-(4-chloro-2-cyanophenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(Cl)cc1C#N |
| InChI | InChI=1S/C13H14ClNO4/c1-2-19-12(17)6-11(16)13(18)10-4-3-9(14)5-8(10)7-15/h3-5,11,13,16,18H,2,6H2,1H3 |
| InChIKey | NIYGYTGHJOZFID-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |