C14H17ClO6 — CID 171897925
2-[4-chloro-2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)phenyl]acetic acid (PubChem CID 171897925) has the molecular formula C14H17ClO6 and a molecular weight of 316.74 g/mol. Its IUPAC name is 2-[4-chloro-2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)phenyl]acetic acid.
| Compound Name | 2-[4-chloro-2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 171897925 |
| Molecular Formula | C14H17ClO6 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[4-chloro-2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)phenyl]acetic acid |
| SMILES | CCOC(=O)CC(O)C(O)c1cc(Cl)ccc1CC(=O)O |
| InChI | InChI=1S/C14H17ClO6/c1-2-21-13(19)7-11(16)14(20)10-6-9(15)4-3-8(10)5-12(17)18/h3-4,6,11,14,16,20H,2,5,7H2,1H3,(H,17,18) |
| InChIKey | GQSRGPLVRMGASC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |