C13H14F2O6 — CID 171897959
4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2,5-difluorobenzoic acid (PubChem CID 171897959) has the molecular formula C13H14F2O6 and a molecular weight of 304.25 g/mol. Its IUPAC name is 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2,5-difluorobenzoic acid.
| Compound Name | 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 171897959 |
| Molecular Formula | C13H14F2O6 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-2,5-difluorobenzoic acid |
| SMILES | CCOC(=O)CC(O)C(O)c1cc(F)c(C(=O)O)cc1F |
| InChI | InChI=1S/C13H14F2O6/c1-2-21-11(17)5-10(16)12(18)6-3-9(15)7(13(19)20)4-8(6)14/h3-4,10,12,16,18H,2,5H2,1H3,(H,19,20) |
| InChIKey | HKZVIRJLZXRREZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |