C13H15FO6 — CID 171897648
2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-fluorobenzoic acid (PubChem CID 171897648) has the molecular formula C13H15FO6 and a molecular weight of 286.26 g/mol. Its IUPAC name is 2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-fluorobenzoic acid.
| Compound Name | 2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 171897648 |
| Molecular Formula | C13H15FO6 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-(4-ethoxy-1,2-dihydroxy-4-oxobutyl)-3-fluorobenzoic acid |
| SMILES | CCOC(=O)CC(O)C(O)c1c(F)cccc1C(=O)O |
| InChI | InChI=1S/C13H15FO6/c1-2-20-10(16)6-9(15)12(17)11-7(13(18)19)4-3-5-8(11)14/h3-5,9,12,15,17H,2,6H2,1H3,(H,18,19) |
| InChIKey | RPTUJBJJAQOUKI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |