C12H13Br2FO4 — CID 171898499
ethyl 4-(2,6-dibromo-4-fluorophenyl)-3,4-dihydroxybutanoate (PubChem CID 171898499) has the molecular formula C12H13Br2FO4 and a molecular weight of 400.04 g/mol. Its IUPAC name is ethyl 4-(2,6-dibromo-4-fluorophenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(2,6-dibromo-4-fluorophenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171898499 |
| Molecular Formula | C12H13Br2FO4 |
| Molecular Weight | 400.04 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | ethyl 4-(2,6-dibromo-4-fluorophenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1c(Br)cc(F)cc1Br |
| InChI | InChI=1S/C12H13Br2FO4/c1-2-19-10(17)5-9(16)12(18)11-7(13)3-6(15)4-8(11)14/h3-4,9,12,16,18H,2,5H2,1H3 |
| InChIKey | JPGBFBADYBGOOE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.04 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |