About methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate
methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate (PubChem CID 171895424) has the molecular formula C13H17FO4
and a molecular weight of 256.27 g/mol. Its IUPAC name is methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate.
Analyze methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate?
The IUPAC name of methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate (CID 171895424) is methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate.
What is the SMILES notation for methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate?
The canonical SMILES for methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate is COC(=O)CC(O)C(O)c1c(C)cc(F)cc1C.
What is the InChIKey of methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate?
The InChIKey is SHAQLVYQDGBJIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FO4/c1-7-4-9(14)5-8(2)12(7)13(17)10(15)6-11(16)18-3/h4-5,10,13,15,17H,6H2,1-3H3.
What are the key properties of methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate?
methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate has a molecular weight of 256.27 g/mol, XLogP of 1.40, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate is sourced from PubChem (CID 171895424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).